C32H44NO8+ — CID 153278287
2-[2-[(E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoyl]oxypropoxy]ethyl-[2-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxypropoxy]ethyl]-dimethylazanium (PubChem CID 153278287) has the molecular formula C32H44NO8+ and a molecular weight of 570.70 g/mol. Its IUPAC name is 2-[2-[(E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoyl]oxypropoxy]ethyl-[2-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxypropoxy]ethyl]-dimethylazanium.
| Compound Name | 2-[2-[(E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoyl]oxypropoxy]ethyl-[2-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxypropoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 153278287 |
| Molecular Formula | C32H44NO8+ |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | 2-[2-[(E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoyl]oxypropoxy]ethyl-[2-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxypropoxy]ethyl]-dimethylazanium |
| SMILES | COc1ccc(/C=C/C(=O)OC(C)COCC[N+](C)(C)CCOCC(C)OC(=O)/C=C/c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C32H44NO8/c1-25(40-31(35)16-12-27-6-8-29(22-34)9-7-27)23-38-20-18-33(3,4)19-21-39-24-26(2)41-32(36)17-13-28-10-14-30(37-5)15-11-28/h6-17,25-26,34H,18-24H2,1-5H3/q+1/b16-12+,17-13+ |
| InChIKey | IXNQCHAJPAABGI-UNZYHPAISA-N |
| XLogP | 3.89 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|