C14H16O6 — CID 16661967
(1,4-dihydroxy-3-oxobutan-2-yl) (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 16661967) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (1,4-dihydroxy-3-oxobutan-2-yl) (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | (1,4-dihydroxy-3-oxobutan-2-yl) (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16661967 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1,4-dihydroxy-3-oxobutan-2-yl) (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC(CO)C(=O)CO)cc1 |
| InChI | InChI=1S/C14H16O6/c1-19-11-5-2-10(3-6-11)4-7-14(18)20-13(9-16)12(17)8-15/h2-7,13,15-16H,8-9H2,1H3/b7-4+ |
| InChIKey | HBJYVSHCJIBSBA-QPJJXVBHSA-N |
| XLogP | 0.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|