C23H27B3O6 — CID 153280618
[4-[2,4-bis(4-boronophenyl)pentan-3-yl]phenyl]boronic acid (PubChem CID 153280618) has the molecular formula C23H27B3O6 and a molecular weight of 431.90 g/mol. Its IUPAC name is [4-[2,4-bis(4-boronophenyl)pentan-3-yl]phenyl]boronic acid.
| Compound Name | [4-[2,4-bis(4-boronophenyl)pentan-3-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 153280618 |
| Molecular Formula | C23H27B3O6 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [4-[2,4-bis(4-boronophenyl)pentan-3-yl]phenyl]boronic acid |
| SMILES | CC(c1ccc(B(O)O)cc1)C(c1ccc(B(O)O)cc1)C(C)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C23H27B3O6/c1-15(17-3-9-20(10-4-17)24(27)28)23(19-7-13-22(14-8-19)26(31)32)16(2)18-5-11-21(12-6-18)25(29)30/h3-16,23,27-32H,1-2H3 |
| InChIKey | LZPZTKOTEQGVME-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|