C16H10BClFN4O3 — CID 153280818
CID 153280818 (PubChem CID 153280818) has the molecular formula C16H10BClFN4O3 and a molecular weight of 371.54 g/mol.
| Compound Name | CID 153280818 |
|---|---|
| PubChem CID | 153280818 |
| Molecular Formula | C16H10BClFN4O3 |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | — |
| SMILES | O=C[B]Nc1nc(C(=O)Nc2cc(-c3ccc(F)nc3)ccc2Cl)co1 |
| InChI | InChI=1S/C16H10BClFN4O3/c18-11-3-1-9(10-2-4-14(19)20-6-10)5-12(11)21-15(25)13-7-26-16(22-13)23-17-8-24/h1-8H,(H,21,25)(H,22,23) |
| InChIKey | GWEMMLQFGCGRTD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|