C21H24ClN5O3 — CID 135186965
2-amino-N-[2-chloro-5-[6-[3-(propan-2-ylamino)propoxy]-3-pyridinyl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 135186965) has the molecular formula C21H24ClN5O3 and a molecular weight of 429.91 g/mol. Its IUPAC name is 2-amino-N-[2-chloro-5-[6-[3-(propan-2-ylamino)propoxy]-3-pyridinyl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-amino-N-[2-chloro-5-[6-[3-(propan-2-ylamino)propoxy]-3-pyridinyl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 135186965 |
| Molecular Formula | C21H24ClN5O3 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-amino-N-[2-chloro-5-[6-[3-(propan-2-ylamino)propoxy]-3-pyridinyl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)NCCCOc1ccc(-c2ccc(Cl)c(NC(=O)c3coc(N)n3)c2)cn1 |
| InChI | InChI=1S/C21H24ClN5O3/c1-13(2)24-8-3-9-29-19-7-5-15(11-25-19)14-4-6-16(22)17(10-14)26-20(28)18-12-30-21(23)27-18/h4-7,10-13,24H,3,8-9H2,1-2H3,(H2,23,27)(H,26,28) |
| InChIKey | DVFOESHWPKGAJU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|