C70H40N2 — CID 153283347
N-[4-[4-[3-[3,5-bis(2,3-diethynylphenyl)phenyl]-N-(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline (PubChem CID 153283347) has the molecular formula C70H40N2 and a molecular weight of 909.10 g/mol. Its IUPAC name is N-[4-[4-[3-[3,5-bis(2,3-diethynylphenyl)phenyl]-N-(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline.
| Compound Name | N-[4-[4-[3-[3,5-bis(2,3-diethynylphenyl)phenyl]-N-(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline |
|---|---|
| PubChem CID | 153283347 |
| Molecular Formula | C70H40N2 |
| Molecular Weight | 909.10 g/mol |
| Exact Mass | 908.32 |
| IUPAC Name | N-[4-[4-[3-[3,5-bis(2,3-diethynylphenyl)phenyl]-N-(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline |
| SMILES | C#Cc1cccc(-c2cc(-c3cccc(N(c4ccc(-c5ccc(N(c6ccccc6)c6cccc(C#C)c6C#C)cc5)cc4)c4cccc(C#C)c4C#C)c3)cc(-c3cccc(C#C)c3C#C)c2)c1C#C |
| InChI | InChI=1S/C70H40N2/c1-9-49-25-21-33-67(63(49)13-5)57-45-56(46-58(47-57)68-34-22-26-50(10-2)64(68)14-6)55-29-20-32-62(48-55)72(70-36-24-28-52(12-4)66(70)16-8)61-43-39-54(40-44-61)53-37-41-60(42-38-53)71(59-30-18-17-19-31-59)69-35-23-27-51(11-3)65(69)15-7/h1-8,17-48H |
| InChIKey | XYZMKTOIZXQWOB-UHFFFAOYSA-N |
| XLogP | 15.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.10 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|