C54H32N2 — CID 153283376
N-[4-[4-[N,3-bis(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline (PubChem CID 153283376) has the molecular formula C54H32N2 and a molecular weight of 708.86 g/mol. Its IUPAC name is N-[4-[4-[N,3-bis(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline.
| Compound Name | N-[4-[4-[N,3-bis(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline |
|---|---|
| PubChem CID | 153283376 |
| Molecular Formula | C54H32N2 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | N-[4-[4-[N,3-bis(2,3-diethynylphenyl)anilino]phenyl]phenyl]-2,3-diethynyl-N-phenylaniline |
| SMILES | C#Cc1cccc(-c2cccc(N(c3ccc(-c4ccc(N(c5ccccc5)c5cccc(C#C)c5C#C)cc4)cc3)c3cccc(C#C)c3C#C)c2)c1C#C |
| InChI | InChI=1S/C54H32N2/c1-7-39-20-17-27-52(49(39)10-4)44-23-16-26-48(38-44)56(54-29-19-22-41(9-3)51(54)12-6)47-36-32-43(33-37-47)42-30-34-46(35-31-42)55(45-24-14-13-15-25-45)53-28-18-21-40(8-2)50(53)11-5/h1-6,13-38H |
| InChIKey | DBZMYOAEXYCUEI-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|