C24H32N2O3 — CID 153284518
methyl (E)-3-(11-ethyl-19-methoxy-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraen-15-yl)prop-2-enoate (PubChem CID 153284518) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is methyl (E)-3-(11-ethyl-19-methoxy-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraen-15-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(11-ethyl-19-methoxy-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraen-15-yl)prop-2-enoate |
|---|---|
| PubChem CID | 153284518 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | methyl (E)-3-(11-ethyl-19-methoxy-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraen-15-yl)prop-2-enoate |
| SMILES | CCC12CCCN(/C=C/C(=O)OC)CCc3c(n(c4ccccc34)CC1)C2OC |
| InChI | InChI=1S/C24H32N2O3/c1-4-24-12-7-14-25(16-11-21(27)28-2)15-10-19-18-8-5-6-9-20(18)26(17-13-24)22(19)23(24)29-3/h5-6,8-9,11,16,23H,4,7,10,12-15,17H2,1-3H3/b16-11+ |
| InChIKey | GCOMTNCCKCSBQA-LFIBNONCSA-N |
| XLogP | 4.45 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|