C34H19N3OPtS — CID 153285649
7-(furan-3-yl)-2-[9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) (PubChem CID 153285649) has the molecular formula C34H19N3OPtS and a molecular weight of 712.69 g/mol. Its IUPAC name is 7-(furan-3-yl)-2-[9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+).
| Compound Name | 7-(furan-3-yl)-2-[9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) |
|---|---|
| PubChem CID | 153285649 |
| Molecular Formula | C34H19N3OPtS |
| Molecular Weight | 712.69 g/mol |
| Exact Mass | 712.09 |
| IUPAC Name | 7-(furan-3-yl)-2-[9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(-c2ccccn2)cccc1-n1c2[c-]c(-c3nc4cccc(-c5ccoc5)c4s3)ccc2c2ccccc21 |
| InChI | InChI=1S/C34H19N3OS.Pt/c1-2-13-31-27(9-1)28-15-14-23(34-36-30-12-6-10-26(33(30)39-34)24-16-18-38-21-24)20-32(28)37(31)25-8-5-7-22(19-25)29-11-3-4-17-35-29;/h1-18,21H;/q-2;+2 |
| InChIKey | VKRPMGDIUVHHAU-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.69 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|