C18H24N4 — CID 153288688
5-[(4-piperidin-1-ylphenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 153288688) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 5-[(4-piperidin-1-ylphenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 5-[(4-piperidin-1-ylphenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 153288688 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 5-[(4-piperidin-1-ylphenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | c1nc2c([nH]1)CN(Cc1ccc(N3CCCCC3)cc1)CC2 |
| InChI | InChI=1S/C18H24N4/c1-2-9-22(10-3-1)16-6-4-15(5-7-16)12-21-11-8-17-18(13-21)20-14-19-17/h4-7,14H,1-3,8-13H2,(H,19,20) |
| InChIKey | QWEWJLHLCFZDMD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|