C29H42N4O7S — CID 153290342
methyl 2-[(1R,3R)-1-[4-(1-imino-3-oxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)butoxy]-4-methyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl]-1,3-thiazole-4-carboxylate (PubChem CID 153290342) has the molecular formula C29H42N4O7S and a molecular weight of 590.74 g/mol. Its IUPAC name is methyl 2-[(1R,3R)-1-[4-(1-imino-3-oxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)butoxy]-4-methyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(1R,3R)-1-[4-(1-imino-3-oxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)butoxy]-4-methyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 153290342 |
| Molecular Formula | C29H42N4O7S |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | methyl 2-[(1R,3R)-1-[4-(1-imino-3-oxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)butoxy]-4-methyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentyl]-1,3-thiazole-4-carboxylate |
| SMILES | [H]/N=C1/C2C3C=CC(O3)C2C(=O)N1CCCCO[C@H](C[C@H](C(C)C)N(C)C(=O)OC(C)(C)C)c1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C29H42N4O7S/c1-16(2)18(32(6)28(36)40-29(3,4)5)14-21(25-31-17(15-41-25)27(35)37-7)38-13-9-8-12-33-24(30)22-19-10-11-20(39-19)23(22)26(33)34/h10-11,15-16,18-23,30H,8-9,12-14H2,1-7H3/b30-24-/t18-,19?,20?,21-,22?,23?/m1/s1 |
| InChIKey | AVAGZXAGPNKRDF-BUXNZNLLSA-N |
| XLogP | 4.44 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|