C23H23ClF4N4O2 — CID 153290615
[1-[(3-chloro-4-fluorophenyl)methyl]-2-(1,4-diazepan-1-yl)-5,6-dimethylbenzimidazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 153290615) has the molecular formula C23H23ClF4N4O2 and a molecular weight of 498.91 g/mol. Its IUPAC name is [1-[(3-chloro-4-fluorophenyl)methyl]-2-(1,4-diazepan-1-yl)-5,6-dimethylbenzimidazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[(3-chloro-4-fluorophenyl)methyl]-2-(1,4-diazepan-1-yl)-5,6-dimethylbenzimidazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 153290615 |
| Molecular Formula | C23H23ClF4N4O2 |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [1-[(3-chloro-4-fluorophenyl)methyl]-2-(1,4-diazepan-1-yl)-5,6-dimethylbenzimidazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc2c(nc(N3CCCNCC3)n2Cc2ccc(F)c(Cl)c2)c(OC(=O)C(F)(F)F)c1C |
| InChI | InChI=1S/C23H23ClF4N4O2/c1-13-10-18-19(20(14(13)2)34-21(33)23(26,27)28)30-22(31-8-3-6-29-7-9-31)32(18)12-15-4-5-17(25)16(24)11-15/h4-5,10-11,29H,3,6-9,12H2,1-2H3 |
| InChIKey | ZIBKWGLSBZZFLX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|