C26H21ClF4N4O2 — CID 153290652
[1-[(3-chloro-4-fluorophenyl)methyl]-4-phenyl-2-piperazin-1-ylbenzimidazol-5-yl] 2,2,2-trifluoroacetate (PubChem CID 153290652) has the molecular formula C26H21ClF4N4O2 and a molecular weight of 532.93 g/mol. Its IUPAC name is [1-[(3-chloro-4-fluorophenyl)methyl]-4-phenyl-2-piperazin-1-ylbenzimidazol-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[(3-chloro-4-fluorophenyl)methyl]-4-phenyl-2-piperazin-1-ylbenzimidazol-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 153290652 |
| Molecular Formula | C26H21ClF4N4O2 |
| Molecular Weight | 532.93 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | [1-[(3-chloro-4-fluorophenyl)methyl]-4-phenyl-2-piperazin-1-ylbenzimidazol-5-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc2c(nc(N3CCNCC3)n2Cc2ccc(F)c(Cl)c2)c1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H21ClF4N4O2/c27-18-14-16(6-7-19(18)28)15-35-20-8-9-21(37-24(36)26(29,30)31)22(17-4-2-1-3-5-17)23(20)33-25(35)34-12-10-32-11-13-34/h1-9,14,32H,10-13,15H2 |
| InChIKey | RQONMDAOAMCNLW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.93 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|