C39H26N3OPS — CID 153291853
2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylbenzo[b][1,4]benzothiaphosphinine 10-oxide (PubChem CID 153291853) has the molecular formula C39H26N3OPS and a molecular weight of 615.70 g/mol. Its IUPAC name is 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylbenzo[b][1,4]benzothiaphosphinine 10-oxide.
| Compound Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylbenzo[b][1,4]benzothiaphosphinine 10-oxide |
|---|---|
| PubChem CID | 153291853 |
| Molecular Formula | C39H26N3OPS |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenylbenzo[b][1,4]benzothiaphosphinine 10-oxide |
| SMILES | O=P1(c2ccccc2)c2ccccc2Sc2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc21 |
| InChI | InChI=1S/C39H26N3OPS/c43-44(32-16-8-3-9-17-32)33-18-10-11-19-35(33)45-36-25-24-31(26-34(36)44)27-20-22-30(23-21-27)39-41-37(28-12-4-1-5-13-28)40-38(42-39)29-14-6-2-7-15-29/h1-26H |
| InChIKey | NTSWRQAQVPNPCC-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|