C20H34B2O4 — CID 153293117
CID 153293117 (PubChem CID 153293117) has the molecular formula C20H34B2O4 and a molecular weight of 360.11 g/mol.
| Compound Name | CID 153293117 |
|---|---|
| PubChem CID | 153293117 |
| Molecular Formula | C20H34B2O4 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | — |
| SMILES | Cc1c([B]OC(C)(C)C(C)(C)O)ccc([B]OC(C)(C)C(C)(C)O)c1C |
| InChI | InChI=1S/C20H34B2O4/c1-13-14(2)16(22-26-20(9,10)18(5,6)24)12-11-15(13)21-25-19(7,8)17(3,4)23/h11-12,23-24H,1-10H3 |
| InChIKey | XDRKZRYYRSWEIJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|