C9H16NO3S- — CID 153294150
2-(2-bicyclo[2.2.1]heptanylamino)ethanesulfonate (PubChem CID 153294150) has the molecular formula C9H16NO3S- and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylamino)ethanesulfonate.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylamino)ethanesulfonate |
|---|---|
| PubChem CID | 153294150 |
| Molecular Formula | C9H16NO3S- |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylamino)ethanesulfonate |
| SMILES | O=S(=O)([O-])CCNC1CC2CCC1C2 |
| InChI | InChI=1S/C9H17NO3S/c11-14(12,13)4-3-10-9-6-7-1-2-8(9)5-7/h7-10H,1-6H2,(H,11,12,13)/p-1 |
| InChIKey | WLHYKGXWBWSYKL-UHFFFAOYSA-M |
| XLogP | 0.31 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|