C30H13BN4O3 — CID 153294547
16-(3-isocyanophenyl)-18-(4-isocyanophenyl)-8,14,22-trioxa-5,11-diaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 153294547) has the molecular formula C30H13BN4O3 and a molecular weight of 488.27 g/mol. Its IUPAC name is 16-(3-isocyanophenyl)-18-(4-isocyanophenyl)-8,14,22-trioxa-5,11-diaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 16-(3-isocyanophenyl)-18-(4-isocyanophenyl)-8,14,22-trioxa-5,11-diaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 153294547 |
| Molecular Formula | C30H13BN4O3 |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 16-(3-isocyanophenyl)-18-(4-isocyanophenyl)-8,14,22-trioxa-5,11-diaza-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | [C-]#[N+]c1ccc(-c2cc(-c3cccc([N+]#[C-])c3)c3c4c2Oc2cncc5c2B4c2c(cncc2O3)O5)cc1 |
| InChI | InChI=1S/C30H13BN4O3/c1-32-18-8-6-16(7-9-18)20-11-21(17-4-3-5-19(10-17)33-2)30-28-29(20)37-24-14-34-12-22-26(24)31(28)27-23(36-22)13-35-15-25(27)38-30/h3-15H |
| InChIKey | HSWCPSKKLDBZMK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 62.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|