C15H17N7O3 — CID 153294739
4-[[5-(4-phenylbutyl)tetrazol-1-yl]methylamino]-1,2,5-oxadiazole-3-carboxylic acid (PubChem CID 153294739) has the molecular formula C15H17N7O3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 4-[[5-(4-phenylbutyl)tetrazol-1-yl]methylamino]-1,2,5-oxadiazole-3-carboxylic acid.
| Compound Name | 4-[[5-(4-phenylbutyl)tetrazol-1-yl]methylamino]-1,2,5-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 153294739 |
| Molecular Formula | C15H17N7O3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-[[5-(4-phenylbutyl)tetrazol-1-yl]methylamino]-1,2,5-oxadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1nonc1NCn1nnnc1CCCCc1ccccc1 |
| InChI | InChI=1S/C15H17N7O3/c23-15(24)13-14(19-25-18-13)16-10-22-12(17-20-21-22)9-5-4-8-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,16,19)(H,23,24) |
| InChIKey | ONEIKWYBHMWAQB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|