C15H20N4O — CID 71860522
1-(oxolan-2-ylmethyl)-5-(3-phenylpropyl)tetrazole (PubChem CID 71860522) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-5-(3-phenylpropyl)tetrazole.
| Compound Name | 1-(oxolan-2-ylmethyl)-5-(3-phenylpropyl)tetrazole |
|---|---|
| PubChem CID | 71860522 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-5-(3-phenylpropyl)tetrazole |
| SMILES | c1ccc(CCCc2nnnn2CC2CCCO2)cc1 |
| InChI | InChI=1S/C15H20N4O/c1-2-6-13(7-3-1)8-4-10-15-16-17-18-19(15)12-14-9-5-11-20-14/h1-3,6-7,14H,4-5,8-12H2 |
| InChIKey | FHQLGERTIXOAJP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |