C13H16N4OS — CID 47124186
1-benzyl-5-(oxolan-2-ylmethylsulfanyl)tetrazole (PubChem CID 47124186) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-benzyl-5-(oxolan-2-ylmethylsulfanyl)tetrazole.
| Compound Name | 1-benzyl-5-(oxolan-2-ylmethylsulfanyl)tetrazole |
|---|---|
| PubChem CID | 47124186 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-benzyl-5-(oxolan-2-ylmethylsulfanyl)tetrazole |
| SMILES | c1ccc(Cn2nnnc2SCC2CCCO2)cc1 |
| InChI | InChI=1S/C13H16N4OS/c1-2-5-11(6-3-1)9-17-13(14-15-16-17)19-10-12-7-4-8-18-12/h1-3,5-6,12H,4,7-10H2 |
| InChIKey | AICDVQIINVJMRF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |