C31H38FN3O5 — CID 153294802
N-[4-[[5-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-1-methyl-2-oxo-4-pyridinyl]oxy]cyclohexyl]acetohydrazide (PubChem CID 153294802) has the molecular formula C31H38FN3O5 and a molecular weight of 551.66 g/mol. Its IUPAC name is N-[4-[[5-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-1-methyl-2-oxo-4-pyridinyl]oxy]cyclohexyl]acetohydrazide.
| Compound Name | N-[4-[[5-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-1-methyl-2-oxo-4-pyridinyl]oxy]cyclohexyl]acetohydrazide |
|---|---|
| PubChem CID | 153294802 |
| Molecular Formula | C31H38FN3O5 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-[4-[[5-[2-(4-fluoro-2,6-dimethylphenoxy)-5-(2-hydroxypropan-2-yl)phenyl]-1-methyl-2-oxo-4-pyridinyl]oxy]cyclohexyl]acetohydrazide |
| SMILES | CC(=O)N(N)C1CCC(Oc2cc(=O)n(C)cc2-c2cc(C(C)(C)O)ccc2Oc2c(C)cc(F)cc2C)CC1 |
| InChI | InChI=1S/C31H38FN3O5/c1-18-13-22(32)14-19(2)30(18)40-27-12-7-21(31(4,5)38)15-25(27)26-17-34(6)29(37)16-28(26)39-24-10-8-23(9-11-24)35(33)20(3)36/h7,12-17,23-24,38H,8-11,33H2,1-6H3 |
| InChIKey | WDBXJOAHWTYSLU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|