C14H21BrClN3O3 — CID 153294813
N-[4-[(5-bromo-1-methyl-2-oxo-4-pyridinyl)oxy]cyclohexyl]acetohydrazide;hydrochloride (PubChem CID 153294813) has the molecular formula C14H21BrClN3O3 and a molecular weight of 394.70 g/mol. Its IUPAC name is N-[4-[(5-bromo-1-methyl-2-oxo-4-pyridinyl)oxy]cyclohexyl]acetohydrazide;hydrochloride.
| Compound Name | N-[4-[(5-bromo-1-methyl-2-oxo-4-pyridinyl)oxy]cyclohexyl]acetohydrazide;hydrochloride |
|---|---|
| PubChem CID | 153294813 |
| Molecular Formula | C14H21BrClN3O3 |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | N-[4-[(5-bromo-1-methyl-2-oxo-4-pyridinyl)oxy]cyclohexyl]acetohydrazide;hydrochloride |
| SMILES | CC(=O)N(N)C1CCC(Oc2cc(=O)n(C)cc2Br)CC1.Cl |
| InChI | InChI=1S/C14H20BrN3O3.ClH/c1-9(19)18(16)10-3-5-11(6-4-10)21-13-7-14(20)17(2)8-12(13)15;/h7-8,10-11H,3-6,16H2,1-2H3;1H |
| InChIKey | VXCQEYKENGPPEN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|