C20H18F17N3O7 — CID 153295583
1-[3-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)-3-hydroxypropoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 153295583) has the molecular formula C20H18F17N3O7 and a molecular weight of 735.34 g/mol. Its IUPAC name is 1-[3-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)-3-hydroxypropoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)-3-hydroxypropoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 153295583 |
| Molecular Formula | C20H18F17N3O7 |
| Molecular Weight | 735.34 g/mol |
| Exact Mass | 735.09 |
| IUPAC Name | 1-[3-[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylamino)-3-hydroxypropoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2OC(CO)C(O)C2OCC(CO)NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C20H18F17N3O7/c21-13(22,15(25,26)17(29,30)19(33,34)35)14(23,24)16(27,28)18(31,32)20(36,37)39-6(3-41)5-46-10-9(44)7(4-42)47-11(10)40-2-1-8(43)38-12(40)45/h1-2,6-7,9-11,39,41-42,44H,3-5H2,(H,38,43,45) |
| InChIKey | UYTBCXJZQDNHBL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|