C27H35ClF5N5O4 — CID 153295895
amino 2-[(2R,5S)-2-[[[4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-1-ethylpyrazole-3-carbonyl]amino]methyl]-5-methylpiperidin-1-yl]acetate (PubChem CID 153295895) has the molecular formula C27H35ClF5N5O4 and a molecular weight of 624.05 g/mol. Its IUPAC name is amino 2-[(2R,5S)-2-[[[4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-1-ethylpyrazole-3-carbonyl]amino]methyl]-5-methylpiperidin-1-yl]acetate.
| Compound Name | amino 2-[(2R,5S)-2-[[[4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-1-ethylpyrazole-3-carbonyl]amino]methyl]-5-methylpiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 153295895 |
| Molecular Formula | C27H35ClF5N5O4 |
| Molecular Weight | 624.05 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | amino 2-[(2R,5S)-2-[[[4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-1-ethylpyrazole-3-carbonyl]amino]methyl]-5-methylpiperidin-1-yl]acetate |
| SMILES | CCn1nc(C(=O)NC[C@H]2CC[C@H](C)CN2CC(=O)ON)c(Cl)c1-c1ccc(CC(C)(C)C(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C27H35ClF5N5O4/c1-5-38-23(18-9-7-16(10-19(18)41-25(29)30)11-26(3,4)27(31,32)33)21(28)22(36-38)24(40)35-12-17-8-6-15(2)13-37(17)14-20(39)42-34/h7,9-10,15,17,25H,5-6,8,11-14,34H2,1-4H3,(H,35,40)/t15-,17+/m0/s1 |
| InChIKey | FLDOFAAZBVZHON-DOTOQJQBSA-N |
| XLogP | 5.20 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.05 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|