C26H33ClF5N3O4 — CID 153296146
4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-N-[[(1S,2S,4S)-1,2-dihydroxy-4-methylcyclohexyl]methyl]-1-ethylpyrazole-3-carboxamide (PubChem CID 153296146) has the molecular formula C26H33ClF5N3O4 and a molecular weight of 582.01 g/mol. Its IUPAC name is 4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-N-[[(1S,2S,4S)-1,2-dihydroxy-4-methylcyclohexyl]methyl]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-N-[[(1S,2S,4S)-1,2-dihydroxy-4-methylcyclohexyl]methyl]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 153296146 |
| Molecular Formula | C26H33ClF5N3O4 |
| Molecular Weight | 582.01 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | 4-chloro-5-[2-(difluoromethoxy)-4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-N-[[(1S,2S,4S)-1,2-dihydroxy-4-methylcyclohexyl]methyl]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C(=O)NC[C@@]2(O)CC[C@H](C)C[C@@H]2O)c(Cl)c1-c1ccc(CC(C)(C)C(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C26H33ClF5N3O4/c1-5-35-21(16-7-6-15(11-17(16)39-23(28)29)12-24(3,4)26(30,31)32)19(27)20(34-35)22(37)33-13-25(38)9-8-14(2)10-18(25)36/h6-7,11,14,18,23,36,38H,5,8-10,12-13H2,1-4H3,(H,33,37)/t14-,18-,25-/m0/s1 |
| InChIKey | WMILRUXPWPXVMQ-KIKZRXFUSA-N |
| XLogP | 5.60 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |