C12H22N2OS — CID 153296109
(S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide (PubChem CID 153296109) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is (S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 153296109 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide |
| SMILES | CC1CCC(C#N)(N[S@@](=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22N2OS/c1-10-5-7-12(9-13,8-6-10)14-16(15)11(2,3)4/h10,14H,5-8H2,1-4H3/t10?,12?,16-/m0/s1 |
| InChIKey | HKXGBKNSMOEUMD-MLHMAEKDSA-N |
| XLogP | 2.51 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |