C12H22N2O3S2 — CID 158218703
(S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide;sulfur dioxide (PubChem CID 158218703) has the molecular formula C12H22N2O3S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide;sulfur dioxide.
| Compound Name | (S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide;sulfur dioxide |
|---|---|
| PubChem CID | 158218703 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (S)-N-(1-cyano-4-methylcyclohexyl)-2-methylpropane-2-sulfinamide;sulfur dioxide |
| SMILES | CC1CCC(C#N)(N[S@@](=O)C(C)(C)C)CC1.O=S=O |
| InChI | InChI=1S/C12H22N2OS.O2S/c1-10-5-7-12(9-13,8-6-10)14-16(15)11(2,3)4;1-3-2/h10,14H,5-8H2,1-4H3;/t10?,12?,16-;/m0./s1 |
| InChIKey | GCZCMVUWADFUKX-VRJDZXFQSA-N |
| XLogP | 1.84 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |