C9H18FNO — CID 153298253
(2R,3R,4S)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-ol (PubChem CID 153298253) has the molecular formula C9H18FNO and a molecular weight of 175.25 g/mol. Its IUPAC name is (2R,3R,4S)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-ol.
| Compound Name | (2R,3R,4S)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 153298253 |
| Molecular Formula | C9H18FNO |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2R,3R,4S)-1-tert-butyl-4-fluoro-2-methylpyrrolidin-3-ol |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](F)CN1C(C)(C)C |
| InChI | InChI=1S/C9H18FNO/c1-6-8(12)7(10)5-11(6)9(2,3)4/h6-8,12H,5H2,1-4H3/t6-,7+,8-/m1/s1 |
| InChIKey | IOQLIYZWOQCIEV-GJMOJQLCSA-N |
| XLogP | 1.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |