C26H35N5O6 — CID 153299610
(2S)-2-[[2-[[(2R)-2-[2-amino-3-hydroxy-6-(propanoylamino)phenyl]propanoyl]amino]acetyl]-methylamino]-N-(2-hydroxyethyl)-3-phenylpropanamide (PubChem CID 153299610) has the molecular formula C26H35N5O6 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2R)-2-[2-amino-3-hydroxy-6-(propanoylamino)phenyl]propanoyl]amino]acetyl]-methylamino]-N-(2-hydroxyethyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[[(2R)-2-[2-amino-3-hydroxy-6-(propanoylamino)phenyl]propanoyl]amino]acetyl]-methylamino]-N-(2-hydroxyethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 153299610 |
| Molecular Formula | C26H35N5O6 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | (2S)-2-[[2-[[(2R)-2-[2-amino-3-hydroxy-6-(propanoylamino)phenyl]propanoyl]amino]acetyl]-methylamino]-N-(2-hydroxyethyl)-3-phenylpropanamide |
| SMILES | CCC(=O)Nc1ccc(O)c(N)c1[C@@H](C)C(=O)NCC(=O)N(C)[C@@H](Cc1ccccc1)C(=O)NCCO |
| InChI | InChI=1S/C26H35N5O6/c1-4-21(34)30-18-10-11-20(33)24(27)23(18)16(2)25(36)29-15-22(35)31(3)19(26(37)28-12-13-32)14-17-8-6-5-7-9-17/h5-11,16,19,32-33H,4,12-15,27H2,1-3H3,(H,28,37)(H,29,36)(H,30,34)/t16-,19+/m1/s1 |
| InChIKey | HATYMBIMFRHBIA-APWZRJJASA-N |
| XLogP | 0.72 |
| TPSA | 174.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|