C35H45N7O4 — CID 153306714
(1R,22R,25S)-16-acetyl-13-(2-methylpyrimidin-5-yl)-4,20-dioxo-N-pentyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide (PubChem CID 153306714) has the molecular formula C35H45N7O4 and a molecular weight of 627.79 g/mol. Its IUPAC name is (1R,22R,25S)-16-acetyl-13-(2-methylpyrimidin-5-yl)-4,20-dioxo-N-pentyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide.
| Compound Name | (1R,22R,25S)-16-acetyl-13-(2-methylpyrimidin-5-yl)-4,20-dioxo-N-pentyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide |
|---|---|
| PubChem CID | 153306714 |
| Molecular Formula | C35H45N7O4 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.35 |
| IUPAC Name | (1R,22R,25S)-16-acetyl-13-(2-methylpyrimidin-5-yl)-4,20-dioxo-N-pentyl-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide |
| SMILES | CCCCCNC(=O)[C@@H]1C[C@]23CNC(=O)CCCCCCc4cc(-c5cnc(C)nc5)cc5c(C(C)=O)nn(c45)CC(=O)N1[C@@H]2C3 |
| InChI | InChI=1S/C35H45N7O4/c1-4-5-10-13-36-34(46)28-16-35-17-29(35)42(28)31(45)20-41-33-24(11-8-6-7-9-12-30(44)39-21-35)14-25(26-18-37-23(3)38-19-26)15-27(33)32(40-41)22(2)43/h14-15,18-19,28-29H,4-13,16-17,20-21H2,1-3H3,(H,36,46)(H,39,44)/t28-,29+,35-/m0/s1 |
| InChIKey | XHAUBKBHWOLYIN-AXJWHKOCSA-N |
| XLogP | 4.29 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|