C21H25N — CID 153307051
6-tert-butyl-3-(3-phenylphenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 153307051) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 6-tert-butyl-3-(3-phenylphenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 6-tert-butyl-3-(3-phenylphenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 153307051 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 6-tert-butyl-3-(3-phenylphenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | CC(C)(C)C1C2CN(c3cccc(-c4ccccc4)c3)CC21 |
| InChI | InChI=1S/C21H25N/c1-21(2,3)20-18-13-22(14-19(18)20)17-11-7-10-16(12-17)15-8-5-4-6-9-15/h4-12,18-20H,13-14H2,1-3H3 |
| InChIKey | DYVARNJISPPVFU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |