C16H25FN2 — CID 142422324
6-tert-butyl-3-(2-fluoro-4-pyridinyl)-3-azabicyclo[3.1.0]hexane;ethane (PubChem CID 142422324) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 6-tert-butyl-3-(2-fluoro-4-pyridinyl)-3-azabicyclo[3.1.0]hexane;ethane.
| Compound Name | 6-tert-butyl-3-(2-fluoro-4-pyridinyl)-3-azabicyclo[3.1.0]hexane;ethane |
|---|---|
| PubChem CID | 142422324 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 6-tert-butyl-3-(2-fluoro-4-pyridinyl)-3-azabicyclo[3.1.0]hexane;ethane |
| SMILES | CC.CC(C)(C)C1C2CN(c3ccnc(F)c3)CC21 |
| InChI | InChI=1S/C14H19FN2.C2H6/c1-14(2,3)13-10-7-17(8-11(10)13)9-4-5-16-12(15)6-9;1-2/h4-6,10-11,13H,7-8H2,1-3H3;1-2H3 |
| InChIKey | HOQABFKSMWRMOU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|