C17H19F2N5 — CID 175651543
6-(5-fluoro-6-propan-2-ylpyrimidin-4-yl)-3-(2-fluoro-4-pyridinyl)-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 175651543) has the molecular formula C17H19F2N5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 6-(5-fluoro-6-propan-2-ylpyrimidin-4-yl)-3-(2-fluoro-4-pyridinyl)-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 6-(5-fluoro-6-propan-2-ylpyrimidin-4-yl)-3-(2-fluoro-4-pyridinyl)-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 175651543 |
| Molecular Formula | C17H19F2N5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 6-(5-fluoro-6-propan-2-ylpyrimidin-4-yl)-3-(2-fluoro-4-pyridinyl)-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CC(C)c1ncnc(N2C3CC2CN(c2ccnc(F)c2)C3)c1F |
| InChI | InChI=1S/C17H19F2N5/c1-10(2)16-15(19)17(22-9-21-16)24-12-5-13(24)8-23(7-12)11-3-4-20-14(18)6-11/h3-4,6,9-10,12-13H,5,7-8H2,1-2H3 |
| InChIKey | UMSOXEXVBFDMDM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|