C18H24FN5 — CID 166601004
5-fluoro-4-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-6-propan-2-ylpyrimidine (PubChem CID 166601004) has the molecular formula C18H24FN5 and a molecular weight of 329.42 g/mol. Its IUPAC name is 5-fluoro-4-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-6-propan-2-ylpyrimidine.
| Compound Name | 5-fluoro-4-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-6-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 166601004 |
| Molecular Formula | C18H24FN5 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-fluoro-4-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]-6-propan-2-ylpyrimidine |
| SMILES | Cc1ncccc1CN1CCN(c2ncnc(C(C)C)c2F)CC1 |
| InChI | InChI=1S/C18H24FN5/c1-13(2)17-16(19)18(22-12-21-17)24-9-7-23(8-10-24)11-15-5-4-6-20-14(15)3/h4-6,12-13H,7-11H2,1-3H3 |
| InChIKey | IWZRYQWAWDEWAW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |