C15H18ClN5 — CID 166600720
5-chloro-2-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]pyrimidine (PubChem CID 166600720) has the molecular formula C15H18ClN5 and a molecular weight of 303.80 g/mol. Its IUPAC name is 5-chloro-2-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 166600720 |
| Molecular Formula | C15H18ClN5 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-chloro-2-[4-[(2-methyl-3-pyridinyl)methyl]piperazin-1-yl]pyrimidine |
| SMILES | Cc1ncccc1CN1CCN(c2ncc(Cl)cn2)CC1 |
| InChI | InChI=1S/C15H18ClN5/c1-12-13(3-2-4-17-12)11-20-5-7-21(8-6-20)15-18-9-14(16)10-19-15/h2-4,9-10H,5-8,11H2,1H3 |
| InChIKey | PPYWWWXGJQGMFU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |