C11H14FN3 — CID 122507854
8-(2-fluoro-4-pyridinyl)-3,8-diazabicyclo[3.2.1]octane (PubChem CID 122507854) has the molecular formula C11H14FN3 and a molecular weight of 207.25 g/mol. Its IUPAC name is 8-(2-fluoro-4-pyridinyl)-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 8-(2-fluoro-4-pyridinyl)-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 122507854 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 8-(2-fluoro-4-pyridinyl)-3,8-diazabicyclo[3.2.1]octane |
| SMILES | Fc1cc(N2C3CCC2CNC3)ccn1 |
| InChI | InChI=1S/C11H14FN3/c12-11-5-8(3-4-14-11)15-9-1-2-10(15)7-13-6-9/h3-5,9-10,13H,1-2,6-7H2 |
| InChIKey | FMJODMXKMKWFRM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|