C28H34Si — CID 153307772
diethyl-(3-phenyl-1H-inden-1-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 153307772) has the molecular formula C28H34Si and a molecular weight of 398.67 g/mol. Its IUPAC name is diethyl-(3-phenyl-1H-inden-1-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | diethyl-(3-phenyl-1H-inden-1-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 153307772 |
| Molecular Formula | C28H34Si |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | diethyl-(3-phenyl-1H-inden-1-yl)-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC[Si](CC)(C1C(C)=C(C)C(C)=C1C)C1C=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H34Si/c1-7-29(8-2,28-21(5)19(3)20(4)22(28)6)27-18-26(23-14-10-9-11-15-23)24-16-12-13-17-25(24)27/h9-18,27-28H,7-8H2,1-6H3 |
| InChIKey | JYXCVJQGSBUOID-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|