C55H48F2N2OS — CID 153309693
(Z)-3-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-2-[2-(2,3-difluorophenyl)-4-pyridinyl]prop-2-enenitrile (PubChem CID 153309693) has the molecular formula C55H48F2N2OS and a molecular weight of 823.06 g/mol. Its IUPAC name is (Z)-3-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-2-[2-(2,3-difluorophenyl)-4-pyridinyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-2-[2-(2,3-difluorophenyl)-4-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 153309693 |
| Molecular Formula | C55H48F2N2OS |
| Molecular Weight | 823.06 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | (Z)-3-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-2-[2-(2,3-difluorophenyl)-4-pyridinyl]prop-2-enenitrile |
| SMILES | C=CCCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc(/C=C(\C#N)c6ccnc(-c7cccc(F)c7F)c6)cc5)ccc3-4)s2)cc1 |
| InChI | InChI=1S/C55H48F2N2OS/c1-4-5-6-7-8-9-10-11-31-60-44-23-19-39(20-24-44)52-27-28-53(61-52)42-22-26-46-45-25-21-40(33-48(45)55(2,3)49(46)34-42)38-17-15-37(16-18-38)32-43(36-58)41-29-30-59-51(35-41)47-13-12-14-50(56)54(47)57/h4,12-30,32-35H,1,5-11,31H2,2-3H3/b43-32+ |
| InChIKey | VIWLSTBYPACXAC-WUGRJRDASA-N |
| XLogP | 15.76 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.06 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|