C55H48F2N2OS — CID 153309694
4-[(Z)-2-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-1-isocyanoethenyl]-2-(2,3-difluorophenyl)pyridine (PubChem CID 153309694) has the molecular formula C55H48F2N2OS and a molecular weight of 823.06 g/mol. Its IUPAC name is 4-[(Z)-2-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-1-isocyanoethenyl]-2-(2,3-difluorophenyl)pyridine.
| Compound Name | 4-[(Z)-2-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-1-isocyanoethenyl]-2-(2,3-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 153309694 |
| Molecular Formula | C55H48F2N2OS |
| Molecular Weight | 823.06 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | 4-[(Z)-2-[4-[7-[5-(4-dec-9-enoxyphenyl)thiophen-2-yl]-9,9-dimethylfluoren-2-yl]phenyl]-1-isocyanoethenyl]-2-(2,3-difluorophenyl)pyridine |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc3c(c2)C(C)(C)c2cc(-c4ccc(-c5ccc(OCCCCCCCCC=C)cc5)s4)ccc2-3)cc1)c1ccnc(-c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C55H48F2N2OS/c1-5-6-7-8-9-10-11-12-32-60-43-24-20-39(21-25-43)52-28-29-53(61-52)42-23-27-45-44-26-22-40(34-47(44)55(2,3)48(45)35-42)38-18-16-37(17-19-38)33-50(58-4)41-30-31-59-51(36-41)46-14-13-15-49(56)54(46)57/h5,13-31,33-36H,1,6-12,32H2,2-3H3/b50-33- |
| InChIKey | RYPIKNGHJHKDFE-LNTFTDIZSA-N |
| XLogP | 16.11 |
| TPSA | 26.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.06 |
| LogP ≤ 5 | 16.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|