C33H31FN2OS — CID 143147297
2-[4-(4-ethoxy-3-methylphenyl)butyl]-4-(6-fluoro-3-pyridinyl)-5-(4-phenylphenyl)-1,3-thiazole (PubChem CID 143147297) has the molecular formula C33H31FN2OS and a molecular weight of 522.69 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-3-methylphenyl)butyl]-4-(6-fluoro-3-pyridinyl)-5-(4-phenylphenyl)-1,3-thiazole.
| Compound Name | 2-[4-(4-ethoxy-3-methylphenyl)butyl]-4-(6-fluoro-3-pyridinyl)-5-(4-phenylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 143147297 |
| Molecular Formula | C33H31FN2OS |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 2-[4-(4-ethoxy-3-methylphenyl)butyl]-4-(6-fluoro-3-pyridinyl)-5-(4-phenylphenyl)-1,3-thiazole |
| SMILES | CCOc1ccc(CCCCc2nc(-c3ccc(F)nc3)c(-c3ccc(-c4ccccc4)cc3)s2)cc1C |
| InChI | InChI=1S/C33H31FN2OS/c1-3-37-29-19-13-24(21-23(29)2)9-7-8-12-31-36-32(28-18-20-30(34)35-22-28)33(38-31)27-16-14-26(15-17-27)25-10-5-4-6-11-25/h4-6,10-11,13-22H,3,7-9,12H2,1-2H3 |
| InChIKey | RYRBLSJOEUSXNQ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|