C35H34F3NOS — CID 165167941
3-methyl-7-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine (PubChem CID 165167941) has the molecular formula C35H34F3NOS and a molecular weight of 573.72 g/mol. Its IUPAC name is 3-methyl-7-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine.
| Compound Name | 3-methyl-7-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 165167941 |
| Molecular Formula | C35H34F3NOS |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 3-methyl-7-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
| SMILES | Cc1c(-c2ccc(CC(C)(C)C(F)(F)F)cc2)sc2c(-c3cc4ccccc4c4c3OC(C)(C)C4(C)C)nccc12 |
| InChI | InChI=1S/C35H34F3NOS/c1-20-24-16-17-39-28(26-18-23-10-8-9-11-25(23)27-29(26)40-34(6,7)33(27,4)5)31(24)41-30(20)22-14-12-21(13-15-22)19-32(2,3)35(36,37)38/h8-18H,19H2,1-7H3 |
| InChIKey | VWKODDYHTKTFST-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |