C12H20N2 — CID 153310701
3-tert-butyl-N,N,6-trimethylpyridin-2-amine (PubChem CID 153310701) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-tert-butyl-N,N,6-trimethylpyridin-2-amine.
| Compound Name | 3-tert-butyl-N,N,6-trimethylpyridin-2-amine |
|---|---|
| PubChem CID | 153310701 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-tert-butyl-N,N,6-trimethylpyridin-2-amine |
| SMILES | Cc1ccc(C(C)(C)C)c(N(C)C)n1 |
| InChI | InChI=1S/C12H20N2/c1-9-7-8-10(12(2,3)4)11(13-9)14(5)6/h7-8H,1-6H3 |
| InChIKey | XWZMMESWTAOVMI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |