C48H60N6 — CID 140917962
5,8,15,18,25,28-hexatert-butyl-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26,28-pentadecaene (PubChem CID 140917962) has the molecular formula C48H60N6 and a molecular weight of 721.05 g/mol. Its IUPAC name is 5,8,15,18,25,28-hexatert-butyl-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26,28-pentadecaene.
| Compound Name | 5,8,15,18,25,28-hexatert-butyl-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26,28-pentadecaene |
|---|---|
| PubChem CID | 140917962 |
| Molecular Formula | C48H60N6 |
| Molecular Weight | 721.05 g/mol |
| Exact Mass | 720.49 |
| IUPAC Name | 5,8,15,18,25,28-hexatert-butyl-3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(30),2,4,6,8,10,12,14,16,18,20,22,24,26,28-pentadecaene |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c2nc3c(nc12)c1nc2c(C(C)(C)C)ccc(C(C)(C)C)c2nc1c1nc2c(C(C)(C)C)ccc(C(C)(C)C)c2nc31 |
| InChI | InChI=1S/C48H60N6/c1-43(2,3)25-19-20-26(44(4,5)6)32-31(25)49-37-38(50-32)40-42(54-36-30(48(16,17)18)24-23-29(35(36)52-40)47(13,14)15)41-39(37)51-33-27(45(7,8)9)21-22-28(34(33)53-41)46(10,11)12/h19-24H,1-18H3 |
| InChIKey | GSDWRKITPHSACH-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.05 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|