C29H31N5O3S — CID 153310992
benzyl 4-[4-[2-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]ethyl]phenyl]piperazine-1-carboxylate (PubChem CID 153310992) has the molecular formula C29H31N5O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is benzyl 4-[4-[2-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]ethyl]phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-[2-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]ethyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153310992 |
| Molecular Formula | C29H31N5O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | benzyl 4-[4-[2-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]ethyl]phenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc2c(N)c(C(=O)NCCc3ccc(N4CCN(C(=O)OCc5ccccc5)CC4)cc3)sc2n1 |
| InChI | InChI=1S/C29H31N5O3S/c1-20-7-12-24-25(30)26(38-28(24)32-20)27(35)31-14-13-21-8-10-23(11-9-21)33-15-17-34(18-16-33)29(36)37-19-22-5-3-2-4-6-22/h2-12H,13-19,30H2,1H3,(H,31,35) |
| InChIKey | AXHYOUKBGASIBV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|