C18H16F4N4O3 — CID 153311243
(6-fluoro-1,3-benzoxazol-2-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 153311243) has the molecular formula C18H16F4N4O3 and a molecular weight of 412.34 g/mol. Its IUPAC name is (6-fluoro-1,3-benzoxazol-2-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone.
| Compound Name | (6-fluoro-1,3-benzoxazol-2-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 153311243 |
| Molecular Formula | C18H16F4N4O3 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (6-fluoro-1,3-benzoxazol-2-yl)-[(5S)-5-methyl-3-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2nc3ccc(F)cc3o2)Cc2cnc([C@@](C)(O)C(F)(F)F)n21 |
| InChI | InChI=1S/C18H16F4N4O3/c1-9-7-25(15(27)14-24-12-4-3-10(19)5-13(12)29-14)8-11-6-23-16(26(9)11)17(2,28)18(20,21)22/h3-6,9,28H,7-8H2,1-2H3/t9-,17+/m0/s1 |
| InChIKey | WIVWGJJPMANMAK-HUTHGQBESA-N |
| XLogP | 3.15 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |