C18H16F5N3O4 — CID 155173370
(2,2-difluoro-1,3-benzodioxol-5-yl)-[5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 155173370) has the molecular formula C18H16F5N3O4 and a molecular weight of 433.33 g/mol. Its IUPAC name is (2,2-difluoro-1,3-benzodioxol-5-yl)-[5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone.
| Compound Name | (2,2-difluoro-1,3-benzodioxol-5-yl)-[5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 155173370 |
| Molecular Formula | C18H16F5N3O4 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | (2,2-difluoro-1,3-benzodioxol-5-yl)-[5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | CC1CN(C(=O)c2ccc3c(c2)OC(F)(F)O3)Cc2cnc(C(C)(O)C(F)(F)F)n21 |
| InChI | InChI=1S/C18H16F5N3O4/c1-9-7-25(8-11-6-24-15(26(9)11)16(2,28)17(19,20)21)14(27)10-3-4-12-13(5-10)30-18(22,23)29-12/h3-6,9,28H,7-8H2,1-2H3 |
| InChIKey | LDYGDXKFRFPMHL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |