C43H24F3NO4S3 — CID 153311687
[4-(N-dibenzofuran-2-ylanilino)-8-dibenzothiophen-2-yldibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 153311687) has the molecular formula C43H24F3NO4S3 and a molecular weight of 771.86 g/mol. Its IUPAC name is [4-(N-dibenzofuran-2-ylanilino)-8-dibenzothiophen-2-yldibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-dibenzofuran-2-ylanilino)-8-dibenzothiophen-2-yldibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311687 |
| Molecular Formula | C43H24F3NO4S3 |
| Molecular Weight | 771.86 g/mol |
| Exact Mass | 771.08 |
| IUPAC Name | [4-(N-dibenzofuran-2-ylanilino)-8-dibenzothiophen-2-yldibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3oc4ccccc4c3c2)c2sc3ccc(-c4ccc5sc6ccccc6c5c4)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C43H24F3NO4S3/c44-43(45,46)54(48,49)51-29-23-35-34-21-26(25-14-18-40-33(20-25)31-11-5-7-13-39(31)52-40)15-19-41(34)53-42(35)36(24-29)47(27-8-2-1-3-9-27)28-16-17-38-32(22-28)30-10-4-6-12-37(30)50-38/h1-24H |
| InChIKey | CTYPSFSZFZZZIX-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.86 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|