C57H24F9N3O3 — CID 153311740
4-[3,5-bis[6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridine (PubChem CID 153311740) has the molecular formula C57H24F9N3O3 and a molecular weight of 969.82 g/mol. Its IUPAC name is 4-[3,5-bis[6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridine.
| Compound Name | 4-[3,5-bis[6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 153311740 |
| Molecular Formula | C57H24F9N3O3 |
| Molecular Weight | 969.82 g/mol |
| Exact Mass | 969.17 |
| IUPAC Name | 4-[3,5-bis[6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-6-(2,4,6-trifluorophenyl)-[1]benzofuro[3,2-b]pyridine |
| SMILES | Fc1cc(F)c(-c2cccc3c2oc2c(-c4cc(-c5ccnc6c5oc5c(-c7c(F)cc(F)cc7F)cccc56)cc(-c5ccnc6c5oc5c(-c7c(F)cc(F)cc7F)cccc56)c4)ccnc23)c(F)c1 |
| InChI | InChI=1S/C57H24F9N3O3/c58-28-19-40(61)46(41(62)20-28)34-4-1-7-37-49-55(70-52(34)37)31(10-13-67-49)25-16-26(32-11-14-68-50-38-8-2-5-35(53(38)71-56(32)50)47-42(63)21-29(59)22-43(47)64)18-27(17-25)33-12-15-69-51-39-9-3-6-36(54(39)72-57(33)51)48-44(65)23-30(60)24-45(48)66/h1-24H |
| InChIKey | POSJTOGWGHLUPD-UHFFFAOYSA-N |
| XLogP | 16.82 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.82 |
| LogP ≤ 5 | 16.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |