C11H7NO — CID 11355707
[1]benzofuro[3,2-b]pyridine (PubChem CID 11355707) has the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. Its IUPAC name is [1]benzofuro[3,2-b]pyridine.
| Compound Name | [1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 11355707 |
| Molecular Formula | C11H7NO |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | [1]benzofuro[3,2-b]pyridine |
| SMILES | c1ccc2c(c1)oc1cccnc12 |
| InChI | InChI=1S/C11H7NO/c1-2-5-9-8(4-1)11-10(13-9)6-3-7-12-11/h1-7H |
| InChIKey | FBVBNCGJVKIEHH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |