C32H37NO7 — CID 153315409
(1,3-dioxoisoindol-2-yl) (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 153315409) has the molecular formula C32H37NO7 and a molecular weight of 547.65 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl) (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 153315409 |
| Molecular Formula | C32H37NO7 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C[C@H](CCC(=O)ON1C(=O)c2ccccc2C1=O)[C@H]1CC[C@H]2[C@@H]3C(=O)C[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC(=O)[C@]12C |
| InChI | InChI=1S/C32H37NO7/c1-17(8-11-27(37)40-33-29(38)20-6-4-5-7-21(20)30(33)39)22-9-10-23-28-24(16-26(36)32(22,23)3)31(2)13-12-19(34)14-18(31)15-25(28)35/h4-7,17-18,22-24,28H,8-16H2,1-3H3/t17-,18+,22-,23+,24+,28+,31+,32-/m1/s1 |
| InChIKey | PLKJMBBDMDOJOL-VHZVQZQUSA-N |
| XLogP | 4.74 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|